EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H31ClN6O3 |
| Net Charge | 0 |
| Average Mass | 583.092 |
| Monoisotopic Mass | 582.21462 |
| SMILES | CCOc1cc2ncc(C#N)c(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1NC(=O)/C=C/[C@H]1CCCN1C |
| InChI | InChI=1S/C32H31ClN6O3/c1-3-41-30-17-27-25(16-28(30)38-31(40)12-10-24-8-6-14-39(24)2)32(21(18-34)19-36-27)37-22-9-11-29(26(33)15-22)42-20-23-7-4-5-13-35-23/h4-5,7,9-13,15-17,19,24H,3,6,8,14,20H2,1-2H3,(H,36,37)(H,38,40)/b12-10+/t24-/m1/s1 |
| InChIKey | SADXACCFNXBCFY-IYNHSRRRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrotinib (CHEBI:755675) has role antineoplastic agent (CHEBI:35610) |
| pyrotinib (CHEBI:755675) is a organochlorine compound (CHEBI:36683) |
| pyrotinib (CHEBI:755675) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Pyrotinib | ChEMBL |
| SHR-1258 | ChEMBL |
| Citations |
|---|