EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11ClN2O4 |
| Net Charge | 0 |
| Average Mass | 306.705 |
| Monoisotopic Mass | 306.04073 |
| SMILES | O=C(O)CNC(=O)c1ncc(-c2cccc(Cl)c2)cc1O |
| InChI | InChI=1S/C14H11ClN2O4/c15-10-3-1-2-8(4-10)9-5-11(18)13(16-6-9)14(21)17-7-12(19)20/h1-6,18H,7H2,(H,17,21)(H,19,20) |
| InChIKey | JGRXMPYUTJLTKT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vadadustat (CHEBI:755674) has role anti-anaemic agent (CHEBI:75835) |
| vadadustat (CHEBI:755674) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| AKB-6548 | ChEMBL |
| B-506 | ChEMBL |
| B506 | ChEMBL |
| PG-1016548 | ChEMBL |
| PG1016548 | ChEMBL |
| Vadadustat | ChEMBL |
| Citations |
|---|