EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755673 - molidustat
| Formula | C13H14N8O2 |
| Net Charge | 0 |
| Average Mass | 314.309 |
| Monoisotopic Mass | 314.12397 |
| SMILES | O=c1c(-n2ccnn2)cnn1-c1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C13H14N8O2/c22-13-10(20-2-1-16-18-20)8-17-21(13)12-7-11(14-9-15-12)19-3-5-23-6-4-19/h1-2,7-9,17H,3-6H2 |
| InChIKey | IJMBOKOTALXLKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| molidustat (CHEBI:755673) has role anti-anaemic agent (CHEBI:75835) |
| molidustat (CHEBI:755673) is a dialkylarylamine (CHEBI:23665) |
| molidustat (CHEBI:755673) is a tertiary amino compound (CHEBI:50996) |
| Synonyms | Source |
|---|---|
| BAY 85-3934 | ChEMBL |
| BAY-85-3934 | ChEMBL |
| Molidustat | ChEMBL |
| Citations |
|---|