EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N6O5 |
| Net Charge | 0 |
| Average Mass | 494.552 |
| Monoisotopic Mass | 494.22777 |
| SMILES | COc1c(OC[C@H](O)CN2CCOCC2)ccc2c1N=C(NC(=O)c1cccnc1C)N1CCN=C21 |
| InChI | InChI=1S/C25H30N6O5/c1-16-18(4-3-7-26-16)24(33)29-25-28-21-19(23-27-8-9-31(23)25)5-6-20(22(21)34-2)36-15-17(32)14-30-10-12-35-13-11-30/h3-7,17,32H,8-15H2,1-2H3,(H,28,29,33)/t17-/m1/s1 |
| InChIKey | JGNRMIWLBBNSMU-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bay-1082439 (CHEBI:755672) has role antineoplastic agent (CHEBI:35610) |
| bay-1082439 (CHEBI:755672) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Bay 1082439 | ChEMBL |
| Bay-1082439 | ChEMBL |
| BAY1082439 | ChEMBL |