EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N5O |
| Net Charge | 0 |
| Average Mass | 317.352 |
| Monoisotopic Mass | 317.12766 |
| SMILES | O=c1nnc2c3c(cccc13)N=C(CN1Cc3ccccc3C1)N2 |
| InChI | InChI=1S/C18H15N5O/c24-18-13-6-3-7-14-16(13)17(21-22-18)20-15(19-14)10-23-8-11-4-1-2-5-12(11)9-23/h1-7H,8-10H2,(H,22,24)(H,19,20,21) |
| InChIKey | JLFSBHQQXIAQEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2x-121 (CHEBI:755671) has role antineoplastic agent (CHEBI:35610) |
| 2x-121 (CHEBI:755671) is a phthalazines (CHEBI:38768) |
| Synonyms | Source |
|---|---|
| 2X-121 | ChEMBL |
| E-7449 | ChEMBL |
| E7449 | ChEMBL |
| Parp inhibitor 2x-121 | ChEMBL |
| Stenoparib | ChEMBL |
| Citations |
|---|