EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36N8O2 |
| Net Charge | 0 |
| Average Mass | 564.694 |
| Monoisotopic Mass | 564.29612 |
| SMILES | Cc1cccc(Cn2nc(C3CC3)c3c(NC(=O)c4cnc5cc(OCCN6CCN(C)CC6)ccn45)cccc32)n1 |
| InChI | InChI=1S/C32H36N8O2/c1-22-5-3-6-24(34-22)21-40-27-8-4-7-26(30(27)31(36-40)23-9-10-23)35-32(41)28-20-33-29-19-25(11-12-39(28)29)42-18-17-38-15-13-37(2)14-16-38/h3-8,11-12,19-20,23H,9-10,13-18,21H2,1-2H3,(H,35,41) |
| InChIKey | JUPOTOIJLKDAPF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arry-382 (CHEBI:755670) has role antineoplastic agent (CHEBI:35610) |
| arry-382 (CHEBI:755670) is a indazoles (CHEBI:38769) |
| Synonym | Source |
|---|---|
| Arry-382 | ChEMBL |
| Citations |
|---|