EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClFN5O3 |
| Net Charge | 0 |
| Average Mass | 459.909 |
| Monoisotopic Mass | 459.14735 |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1OC(=O)N1CCN(C)C[C@H]1C |
| InChI | InChI=1S/C22H23ClFN5O3/c1-13-11-28(2)7-8-29(13)22(30)32-19-9-14-17(10-18(19)31-3)25-12-26-21(14)27-16-6-4-5-15(23)20(16)24/h4-6,9-10,12-13H,7-8,11H2,1-3H3,(H,25,26,27)/t13-/m1/s1 |
| InChIKey | MXDSJQHFFDGFDK-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-3759 (CHEBI:755663) has role antineoplastic agent (CHEBI:35610) |
| azd-3759 (CHEBI:755663) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| zorifertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azd 3759 | ChEMBL |
| Azd-3759 | ChEMBL |
| AZD3759 | ChEMBL |
| Citations |
|---|