EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25F3N2O2 |
| Net Charge | 0 |
| Average Mass | 442.481 |
| Monoisotopic Mass | 442.18681 |
| SMILES | C[C@@H]1Cc2c(nc3ccccc23)[C@@H](c2c(F)cc(/C=C/C(=O)O)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C25H25F3N2O2/c1-14-10-17-16-6-4-5-7-20(16)29-23(17)24(30(14)13-25(2,3)28)22-18(26)11-15(12-19(22)27)8-9-21(31)32/h4-9,11-12,14,24,29H,10,13H2,1-3H3,(H,31,32)/b9-8+/t14-,24-/m1/s1 |
| InChIKey | DFBDRVGWBHBJNR-BBNFHIFMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-9496 (CHEBI:755662) has role antineoplastic agent (CHEBI:35610) |
| azd-9496 (CHEBI:755662) is a harmala alkaloid (CHEBI:61379) |
| Synonyms | Source |
|---|---|
| Azd 9496 | ChEMBL |
| Azd-9496 | ChEMBL |
| AZD9496 | ChEMBL |
| Citations |
|---|