EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19F3N6O |
| Net Charge | 0 |
| Average Mass | 380.374 |
| Monoisotopic Mass | 380.15724 |
| SMILES | CC[C@@H]1CN(C(=O)NCC(F)(F)F)C[C@@H]1c1cnc2cnc3nccc3n12 |
| InChI | InChI=1S/C17H19F3N6O/c1-2-10-7-25(16(27)24-9-17(18,19)20)8-11(10)13-5-22-14-6-23-15-12(26(13)14)3-4-21-15/h3-6,10-11,21H,2,7-9H2,1H3,(H,24,27)/t10-,11+/m1/s1 |
| InChIKey | WYQFJHHDOKWSHR-MNOVXSKESA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antirheumatic drug A drug used to treat rheumatoid arthritis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| upadacitinib (CHEBI:755661) has role anti-inflammatory agent (CHEBI:67079) |
| upadacitinib (CHEBI:755661) has role antirheumatic drug (CHEBI:35842) |
| upadacitinib (CHEBI:755661) has role dermatologic drug (CHEBI:50177) |
| upadacitinib (CHEBI:755661) is a pyrrolopyrazine (CHEBI:48337) |
| Synonyms | Source |
|---|---|
| ABT-494 | ChEMBL |
| Upadacitinib | ChEMBL |
| Upadacitinib anhydrous | ChEMBL |
| Brand Name | Source |
|---|---|
| Upadacitinib component of abbv-599 | ChEMBL |
| Citations |
|---|