EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H27NO5 |
| Net Charge | 0 |
| Average Mass | 445.515 |
| Monoisotopic Mass | 445.18892 |
| SMILES | COc1ccc(C(=O)NC2(C(=O)O)Cc3ccccc3C2)cc1OCCc1cccc(C)c1 |
| InChI | InChI=1S/C27H27NO5/c1-18-6-5-7-19(14-18)12-13-33-24-15-20(10-11-23(24)32-2)25(29)28-27(26(30)31)16-21-8-3-4-9-22(21)17-27/h3-11,14-15H,12-13,16-17H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | SOJDTNUCCXWTMG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fipaxalparant (CHEBI:755659) has role antifibrotic agent (CHEBI:233423) |
| fipaxalparant (CHEBI:755659) is a N-acylglycine (CHEBI:16180) |
| INN | Source |
|---|---|
| fipaxalparant | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-003423457 | ChEMBL |
| A003423457 | ChEMBL |
| CZN-001 | ChEMBL |
| CZN001 | ChEMBL |
| HZN-825 | ChEMBL |
| Sar-100842 | ChEMBL |