EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22F3N5O4S |
| Net Charge | 0 |
| Average Mass | 545.543 |
| Monoisotopic Mass | 545.13446 |
| SMILES | Cc1c(-c2ccnn2C)cc(C(=O)NCc2ccc(S(C)(=O)=O)cn2)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F3N5O4S/c1-15-20(22-9-10-31-32(22)2)12-21(23(34)30-13-17-7-8-19(14-29-17)38(3,36)37)24(35)33(15)18-6-4-5-16(11-18)25(26,27)28/h4-12,14H,13H2,1-3H3,(H,30,34) |
| InChIKey | QNQZWEGMKJBHEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alvelestat (CHEBI:755658) has role antineoplastic agent (CHEBI:35610) |
| alvelestat (CHEBI:755658) has role antiviral agent (CHEBI:22587) |
| alvelestat (CHEBI:755658) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| alvelestat | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZD-9668 | ChEMBL |
| AZD9668 | ChEMBL |
| MPH-966 | ChEMBL |
| MPH966 | ChEMBL |
| Citations |
|---|