EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@]12C[C@]([H])([C@H](c3c(OC)cc(C(C)(C)CCCCCC)cc3OC)C=C1CO)C2(C)C |
| InChI | InChI=1S/C27H42O3/c1-8-9-10-11-12-26(2,3)19-14-23(29-6)25(24(15-19)30-7)20-13-18(17-28)21-16-22(20)27(21,4)5/h13-15,20-22,28H,8-12,16-17H2,1-7H3/t20-,21+,22-/m1/s1 |
| InChIKey | CFMRIVODIXTERW-BHIFYINESA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onternabez (CHEBI:755657) has role anticoronaviral agent (CHEBI:149553) |
| onternabez (CHEBI:755657) is a monoterpenoid (CHEBI:25409) |
| Synonyms | Source |
|---|---|
| ARD-S003 | ChEMBL |
| ARDS003 | ChEMBL |
| HU-308 | ChEMBL |
| Onternabez | ChEMBL |
| PPP-003 | ChEMBL |
| Citations |
|---|