EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755655 - cgm-097
| Formula | C38H47ClN4O4 |
| Net Charge | 0 |
| Average Mass | 659.271 |
| Monoisotopic Mass | 658.32858 |
| SMILES | COc1cc2c(cc1OC(C)C)[C@H](c1ccc(Cl)cc1)N(c1ccc(N(C)C[C@H]3CC[C@H](N4CCN(C)C(=O)C4)CC3)cc1)C(=O)C2 |
| InChI | InChI=1S/C38H47ClN4O4/c1-25(2)47-35-22-33-28(20-34(35)46-5)21-36(44)43(38(33)27-8-10-29(39)11-9-27)32-16-14-30(15-17-32)41(4)23-26-6-12-31(13-7-26)42-19-18-40(3)37(45)24-42/h8-11,14-17,20,22,25-26,31,38H,6-7,12-13,18-19,21,23-24H2,1-5H3/t26-,31-,38-/m0/s1 |
| InChIKey | CLRSLRWKONPSRQ-IIPSPAQQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cgm-097 (CHEBI:755655) has role antineoplastic agent (CHEBI:35610) |
| cgm-097 (CHEBI:755655) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| CGM 097 | ChEMBL |
| CGM-097 | ChEMBL |
| CGM097 | ChEMBL |
| NVP-CGM-097 | ChEMBL |
| Citations |
|---|