EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21ClFN3O3S |
| Net Charge | 0 |
| Average Mass | 461.946 |
| Monoisotopic Mass | 461.09762 |
| SMILES | O=C(O)[C@]1(Cc2cccc(Nc3nccs3)n2)CC[C@@H](Oc2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C22H21ClFN3O3S/c23-16-4-2-5-17(19(16)24)30-15-7-9-22(10-8-15,20(28)29)13-14-3-1-6-18(26-14)27-21-25-11-12-31-21/h1-6,11-12,15H,7-10,13H2,(H,28,29)(H,25,26,27)/t15-,22- |
| InChIKey | LCVIRAZGMYMNNT-VVONHTQRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-5108 (CHEBI:755654) has role antineoplastic agent (CHEBI:35610) |
| mk-5108 (CHEBI:755654) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Mk-5108 | ChEMBL |
| MK 5108 | ChEMBL |
| MK5108 | ChEMBL |
| VX-689 | ChEMBL |
| Citations |
|---|