EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22FN7O |
| Net Charge | 0 |
| Average Mass | 407.453 |
| Monoisotopic Mass | 407.18699 |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4c(F)cccc4-n4nccn4)CC3C2)n1 |
| InChI | InChI=1S/C21H22FN7O/c1-13-8-14(2)26-21(25-13)28-11-15-9-27(10-16(15)12-28)20(30)19-17(22)4-3-5-18(19)29-23-6-7-24-29/h3-8,15-16H,9-12H2,1-2H3 |
| InChIKey | SQOCEMCKYDVLMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| seltorexant (CHEBI:755653) has role antidepressant (CHEBI:35469) |
| seltorexant (CHEBI:755653) has role renoprotective agent (CHEBI:231911) |
| seltorexant (CHEBI:755653) is a triazoles (CHEBI:35727) |
| INN | Source |
|---|---|
| seltorexant | WHO MedNet |
| Synonyms | Source |
|---|---|
| JNJ-42847922 | ChEMBL |
| MIN-202 | ChEMBL |
| Citations |
|---|