EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755646 - cc-115
| Formula | C16H16N8O |
| Net Charge | 0 |
| Average Mass | 336.359 |
| Monoisotopic Mass | 336.14471 |
| SMILES | CCN1C(=O)CNc2ncc(-c3ccc(-c4ncnn4)nc3C)nc21 |
| InChI | InChI=1S/C16H16N8O/c1-3-24-13(25)7-18-15-16(24)22-12(6-17-15)10-4-5-11(21-9(10)2)14-19-8-20-23-14/h4-6,8H,3,7H2,1-2H3,(H,17,18)(H,19,20,23) |
| InChIKey | GMYLVKUGJMYTFB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cc-115 (CHEBI:755646) has role antineoplastic agent (CHEBI:35610) |
| cc-115 (CHEBI:755646) is a α-amino acid (CHEBI:33704) |
| Synonym | Source |
|---|---|
| Cc-115 | ChEMBL |
| Citations |
|---|