EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755645 - onatasertib
| Formula | C21H27N5O3 |
| Net Charge | 0 |
| Average Mass | 397.479 |
| Monoisotopic Mass | 397.21139 |
| SMILES | CO[C@H]1CC[C@H](N2C(=O)CNc3ncc(-c4ccc(C(C)(C)O)nc4)nc32)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-21(2,28)17-9-4-13(10-22-17)16-11-23-19-20(25-16)26(18(27)12-24-19)14-5-7-15(29-3)8-6-14/h4,9-11,14-15,28H,5-8,12H2,1-3H3,(H,23,24)/t14-,15- |
| InChIKey | UFKLYTOEMRFKAD-SHTZXODSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onatasertib (CHEBI:755645) has role antineoplastic agent (CHEBI:35610) |
| onatasertib (CHEBI:755645) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| onatasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| ATG-008 | ChEMBL |
| ATG008 | ChEMBL |
| CC-223 | ChEMBL |
| CC223 | ChEMBL |
| Citations |
|---|