EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H20ClFN2O2 |
| Net Charge | 0 |
| Average Mass | 446.909 |
| Monoisotopic Mass | 446.11973 |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccc2nncc2c1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C26H20ClFN2O2/c1-2-21(22-10-9-20(28)14-23(22)27)26(18-8-11-24-19(13-18)15-29-30-24)17-6-3-16(4-7-17)5-12-25(31)32/h3-15H,2H2,1H3,(H,29,30)(H,31,32)/b12-5+,26-21+ |
| InChIKey | BURHGPHDEVGCEZ-KJGLQBJMSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brilanestrant (CHEBI:755644) has role antineoplastic agent (CHEBI:35610) |
| brilanestrant (CHEBI:755644) is a stilbenoid (CHEBI:26776) |
| INN | Source |
|---|---|
| brilanestrant | WHO MedNet |
| Synonyms | Source |
|---|---|
| ARN-810 | ChEMBL |
| GDC-0810 | ChEMBL |
| RG-6046 | ChEMBL |
| RG6046 | ChEMBL |
| Citations |
|---|