EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16BNO4 |
| Net Charge | 0 |
| Average Mass | 237.064 |
| Monoisotopic Mass | 237.11724 |
| SMILES | NC[C@H]1OB(O)c2c(OCCCO)cccc21 |
| InChI | InChI=1S/C11H16BNO4/c13-7-10-8-3-1-4-9(16-6-2-5-14)11(8)12(15)17-10/h1,3-4,10,14-15H,2,5-7,13H2/t10-/m1/s1 |
| InChIKey | FXQIIDINBDJDKL-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epetraborole (CHEBI:755636) has role antibacterial agent (CHEBI:33282) |
| epetraborole (CHEBI:755636) has role antiinfective agent (CHEBI:35441) |
| epetraborole (CHEBI:755636) is a aromatic ether (CHEBI:35618) |
| INNs | Source |
|---|---|
| epetraborol | WHO MedNet |
| epetraborole | WHO MedNet |
| Synonyms | Source |
|---|---|
| AN-3365 | ChEMBL |
| AN3365 | ChEMBL |
| GSK-2251052 | ChEMBL |
| GSK2251052 | ChEMBL |