EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20F2N6 |
| Net Charge | 0 |
| Average Mass | 418.451 |
| Monoisotopic Mass | 418.17175 |
| SMILES | CCNCc1cncc(-c2ccc3c(c2)/C(=C2/N=c4cc(F)cc(F)c4=N2)NN3)c1C |
| InChI | InChI=1S/C23H20F2N6/c1-3-26-9-14-10-27-11-17(12(14)2)13-4-5-19-16(6-13)21(31-30-19)23-28-20-8-15(24)7-18(25)22(20)29-23/h4-8,10-11,26,30-31H,3,9H2,1-2H3/b23-21+ |
| InChIKey | RBOKLZGCVRXGEP-XTQSDGFTSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ag-24322 (CHEBI:755632) has role antineoplastic agent (CHEBI:35610) |
| ag-24322 (CHEBI:755632) is a benzimidazoles (CHEBI:22715) |
| Synonyms | Source |
|---|---|
| Ag 024322 | ChEMBL |
| AG-024322 | ChEMBL |
| Ag-24322 | ChEMBL |