EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C24H23N5O |
| Net Charge | 0 |
| Average Mass | 493.589 |
| Monoisotopic Mass | 493.17838 |
| SMILES | CS(=O)(=O)O.N#CC1(c2ccc(NC(=O)c3cccnc3NCc3ccncc3)cc2)CCCC1 |
| InChI | InChI=1S/C24H23N5O.CH4O3S/c25-17-24(11-1-2-12-24)19-5-7-20(8-6-19)29-23(30)21-4-3-13-27-22(21)28-16-18-9-14-26-15-10-18;1-5(2,3)4/h3-10,13-15H,1-2,11-12,16H2,(H,27,28)(H,29,30);1H3,(H,2,3,4) |
| InChIKey | FYJROXRIVQPKRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivoceranib mesylate (CHEBI:755629) has role antineoplastic agent (CHEBI:35610) |
| rivoceranib mesylate (CHEBI:755629) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| Apatinib mesylate | ChEMBL |
| Apatinib (registered name in China) | ChEMBL |
| Rivoceranib mesylate | ChEMBL |
| YN-968D1 | ChEMBL |
| Brand Name | Source |
|---|---|
| Aitan | ChEMBL |
| Citations |
|---|