EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N6O2 |
| Net Charge | 0 |
| Average Mass | 368.441 |
| Monoisotopic Mass | 368.19607 |
| SMILES | COc1cccc(Nc2ncnn3ccc(CN4CC[C@@H](N)[C@H](O)C4)c23)c1 |
| InChI | InChI=1S/C19H24N6O2/c1-27-15-4-2-3-14(9-15)23-19-18-13(5-8-25(18)22-12-21-19)10-24-7-6-16(20)17(26)11-24/h2-5,8-9,12,16-17,26H,6-7,10-11,20H2,1H3,(H,21,22,23)/t16-,17-/m1/s1 |
| InChIKey | CSGQVNMSRKWUSH-IAGOWNOFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-690514 (CHEBI:755618) has role antineoplastic agent (CHEBI:35610) |
| bms-690514 (CHEBI:755618) is a pyrrolotriazine (CHEBI:88341) |
| Synonyms | Source |
|---|---|
| Bms 6690514 | ChEMBL |
| Bms 690514 | ChEMBL |
| Bms-690514 | ChEMBL |
| Citations |
|---|