EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13BrFN7O4S |
| Net Charge | 0 |
| Average Mass | 438.239 |
| Monoisotopic Mass | 436.99171 |
| SMILES | NS(=O)(=O)NCCNc1nonc1/C(=N/O)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H13BrFN7O4S/c12-7-5-6(1-2-8(7)13)17-11(18-21)9-10(20-24-19-9)15-3-4-16-25(14,22)23/h1-2,5,16,21H,3-4H2,(H,15,20)(H,17,18)(H2,14,22,23) |
| InChIKey | FBKMWOJEPMPVTQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epacadostat (CHEBI:755599) has role antineoplastic agent (CHEBI:35610) |
| epacadostat (CHEBI:755599) is a organofluorine compound (CHEBI:37143) |
| Synonyms | Source |
|---|---|
| Epacadostat | ChEMBL |
| INCB-024360 | ChEMBL |
| INCB024360 | ChEMBL |
| Citations |
|---|