EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20F2N4O2 |
| Net Charge | 0 |
| Average Mass | 410.424 |
| Monoisotopic Mass | 410.15543 |
| SMILES | Cc1ncc(OC[C@@]2(c3cccc(F)c3)C[C@H]2C(=O)Nc2ccc(F)cn2)c(C)n1 |
| InChI | InChI=1S/C22H20F2N4O2/c1-13-19(11-25-14(2)27-13)30-12-22(15-4-3-5-16(23)8-15)9-18(22)21(29)28-20-7-6-17(24)10-26-20/h3-8,10-11,18H,9,12H2,1-2H3,(H,26,28,29)/t18-,22+/m0/s1 |
| InChIKey | MUGXRYIUWFITCP-PGRDOPGGSA-N |
| Roles Classification |
|---|
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lemborexant (CHEBI:755598) has role anticonvulsant (CHEBI:35623) |
| lemborexant (CHEBI:755598) has role renoprotective agent (CHEBI:231911) |
| lemborexant (CHEBI:755598) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| E-2006 | ChEMBL |
| E2006 | ChEMBL |
| Lemborexant | ChEMBL |
| Brand Name | Source |
|---|---|
| Dayvigo | ChEMBL |
| Citations |
|---|