EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C16H13F3N4.HCl |
| Net Charge | 0 |
| Average Mass | 391.224 |
| Monoisotopic Mass | 390.06259 |
| SMILES | Cc1nccn1Cc1cc(-c2ccc(F)c(C(F)F)c2)cnn1.Cl.Cl |
| InChI | InChI=1S/C16H13F3N4.2ClH/c1-10-20-4-5-23(10)9-13-6-12(8-21-22-13)11-2-3-15(17)14(7-11)16(18)19;;/h2-8,16H,9H2,1H3;2*1H |
| InChIKey | OJBLXSPBJMGZDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evt-101 (CHEBI:755588) has role antidepressant (CHEBI:35469) |
| evt-101 (CHEBI:755588) is a pyridazines (CHEBI:37921) |
| evt-101 (CHEBI:755588) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| Evt-101 | ChEMBL |
| Evt101 | ChEMBL |