EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C14H16N2O2 |
| Net Charge | 0 |
| Average Mass | 280.755 |
| Monoisotopic Mass | 280.09786 |
| SMILES | Cl.O=c1nccc2cc(OC3CCNCC3)ccc12 |
| InChI | InChI=1S/C14H16N2O2.ClH/c17-14-13-2-1-12(9-10(13)3-8-16-14)18-11-4-6-15-7-5-11;/h1-3,8-9,11,15H,4-7H2,(H,16,17);1H |
| InChIKey | KMNVOGVCCZNVNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sar-407899 (CHEBI:755584) has role cardiovascular drug (CHEBI:35554) |
| sar-407899 (CHEBI:755584) has role vasodilator agent (CHEBI:35620) |
| sar-407899 (CHEBI:755584) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| SAR-407899 | ChEMBL |
| SAR407899 | ChEMBL |
| Sar-407899 hydrochloride | ChEMBL |