EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N6 |
| Net Charge | 0 |
| Average Mass | 292.346 |
| Monoisotopic Mass | 292.14364 |
| SMILES | c1cnc(NCc2ccc(CNc3ncccn3)cc2)nc1 |
| InChI | InChI=1S/C16H16N6/c1-7-17-15(18-8-1)21-11-13-3-5-14(6-4-13)12-22-16-19-9-2-10-20-16/h1-10H,11-12H2,(H,17,18,21)(H,19,20,22) |
| InChIKey | PXZXYRKDDXKDTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| msx-122 (CHEBI:755580) has role antineoplastic agent (CHEBI:35610) |
| msx-122 (CHEBI:755580) is a secondary amine (CHEBI:32863) |
| Synonyms | Source |
|---|---|
| Msx 122 | ChEMBL |
| Msx-122 | ChEMBL |