EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H47N9O5 |
| Net Charge | 0 |
| Average Mass | 553.709 |
| Monoisotopic Mass | 553.37002 |
| SMILES | [H][C@@]1(C(=O)N[C@@H](C)C(N)=O)CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CCCNC(=N)N)[C@@H](C)CC)C(C)C |
| InChI | InChI=1S/C25H47N9O5/c1-6-14(4)19(33-21(36)16(26)9-7-11-30-25(28)29)23(38)32-18(13(2)3)24(39)34-12-8-10-17(34)22(37)31-15(5)20(27)35/h13-19H,6-12,26H2,1-5H3,(H2,27,35)(H,31,37)(H,32,38)(H,33,36)(H4,28,29,30)/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | ZUJBBVJXXYRPFS-DYKIIFRCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dusquetide (CHEBI:755571) has role anti-inflammatory agent (CHEBI:67079) |
| dusquetide (CHEBI:755571) is a polypeptide (CHEBI:15841) |
| INNs | Source |
|---|---|
| dusquetida | WHO MedNet |
| dusquetide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Arg-ile-val-pro-ala-nh2 | ChEMBL |
| IMX-942 | ChEMBL |
| SGX-94 | ChEMBL |
| SGX94 | ChEMBL |
| SGX-942 | ChEMBL |
| SGX942 | ChEMBL |