EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2.C28H45NO5S |
| Net Charge | 0 |
| Average Mass | 567.789 |
| Monoisotopic Mass | 567.32297 |
| SMILES | CC(=O)O.[H][C@@]12C(=O)CC[C@]13CC[C@@H](C)[C@@]2(C)[C@H](OC(=O)CS[C@@H]1CC[C@@H](N)C[C@H]1O)C[C@@](C)(C=C)[C@@H](O)[C@@H]3C |
| InChI | InChI=1S/C28H45NO5S.C2H4O2/c1-6-26(4)14-22(34-23(32)15-35-21-8-7-18(29)13-20(21)31)27(5)16(2)9-11-28(17(3)25(26)33)12-10-19(30)24(27)28;1-2(3)4/h6,16-18,20-22,24-25,31,33H,1,7-15,29H2,2-5H3;1H3,(H,3,4)/t16-,17+,18-,20-,21-,22-,24+,25+,26-,27+,28+;/m1./s1 |
| InChIKey | WSMXIQXWHPSVDE-ZPJPNJFZSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lefamulin acetate (CHEBI:755568) has role antibacterial agent (CHEBI:33282) |
| lefamulin acetate (CHEBI:755568) is a carbotricyclic compound (CHEBI:38032) |
| lefamulin acetate (CHEBI:755568) is a carboxylic ester (CHEBI:33308) |
| lefamulin acetate (CHEBI:755568) is a cyclic ketone (CHEBI:3992) |
| Synonyms | Source |
|---|---|
| BC-3781.Ac | ChEMBL |
| Lefamulin acetate | ChEMBL |
| Brand Name | Source |
|---|---|
| Xenleta | ChEMBL |