EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H22F2N6O3 |
| Net Charge | 0 |
| Average Mass | 552.541 |
| Monoisotopic Mass | 552.17215 |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Oc3cc4cnn(C)c4cc3-c3cnnc3)c(F)c2)c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C30H22F2N6O3/c1-17-3-9-23(30(40)38(17)22-7-4-20(31)5-8-22)29(39)36-21-6-10-27(25(32)12-21)41-28-11-18-16-35-37(2)26(18)13-24(28)19-14-33-34-15-19/h3-16H,1-2H3,(H,33,34)(H,36,39) |
| InChIKey | QHADVLVFMKEIIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| merestinib (CHEBI:755566) has role antineoplastic agent (CHEBI:35610) |
| merestinib (CHEBI:755566) is a aromatic amide (CHEBI:62733) |
| INN | Source |
|---|---|
| merestinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-2801653 | ChEMBL |
| LY2801653 | ChEMBL |
| Citations |
|---|