EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18F2N6O3 |
| Net Charge | 0 |
| Average Mass | 416.388 |
| Monoisotopic Mass | 416.14084 |
| SMILES | CN(C)C(=O)CCn1nc(Nc2ccc3c(c2)OC(F)(F)O3)nc1-c1ccncc1 |
| InChI | InChI=1S/C19H18F2N6O3/c1-26(2)16(28)7-10-27-17(12-5-8-22-9-6-12)24-18(25-27)23-13-3-4-14-15(11-13)30-19(20,21)29-14/h3-6,8-9,11H,7,10H2,1-2H3,(H,23,25) |
| InChIKey | IURMHZBQEYNQOH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-39393406 (CHEBI:755557) has role antidepressant (CHEBI:35469) |
| jnj-39393406 (CHEBI:755557) has role antipsychotic agent (CHEBI:35476) |
| jnj-39393406 (CHEBI:755557) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| Jnj-39393406 | ChEMBL |