EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20Cl2F2N2O2S |
| Net Charge | 0 |
| Average Mass | 497.394 |
| Monoisotopic Mass | 496.05906 |
| SMILES | CS(=O)(=O)N(c1cc(F)cc(F)c1)C1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H20Cl2F2N2O2S/c1-32(30,31)29(21-11-19(26)10-20(27)12-21)22-13-28(14-22)23(15-2-6-17(24)7-3-15)16-4-8-18(25)9-5-16/h2-12,22-23H,13-14H2,1H3 |
| InChIKey | IQQBRKLVEALROM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| drinabant (CHEBI:755494) has role antipsychotic agent (CHEBI:35476) |
| drinabant (CHEBI:755494) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| drinabant | WHO MedNet |
| Synonym | Source |
|---|---|
| Ave1625 | ChEMBL |