EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20BrN5O2 |
| Net Charge | 0 |
| Average Mass | 466.339 |
| Monoisotopic Mass | 465.08004 |
| SMILES | COc1ccc(Br)cc1NC(=O)Nc1cccc2c1ccn2Cc1ccnc(N)c1 |
| InChI | InChI=1S/C22H20BrN5O2/c1-30-20-6-5-15(23)12-18(20)27-22(29)26-17-3-2-4-19-16(17)8-10-28(19)13-14-7-9-25-21(24)11-14/h2-12H,13H2,1H3,(H2,24,25)(H2,26,27,29) |
| InChIKey | ZXBFYBLSJMEBEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ji-101 (CHEBI:755488) has role antineoplastic agent (CHEBI:35610) |
| ji-101 (CHEBI:755488) is a ureas (CHEBI:47857) |
| Synonyms | Source |
|---|---|
| Angiogenesis inhibitor ji-101 | ChEMBL |
| CGI-1842 | ChEMBL |
| JI-101 | ChEMBL |