EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755454 - xl-228
| Formula | C22H31N9O |
| Net Charge | 0 |
| Average Mass | 437.552 |
| Monoisotopic Mass | 437.26516 |
| SMILES | CC(C)c1cc(CNc2nc(Nc3cc(C4CC4)nn3)cc(N3CCN(C)CC3)n2)on1 |
| InChI | InChI=1S/C22H31N9O/c1-14(2)17-10-16(32-29-17)13-23-22-25-19(24-20-11-18(27-28-20)15-4-5-15)12-21(26-22)31-8-6-30(3)7-9-31/h10-12,14-15H,4-9,13H2,1-3H3,(H3,23,24,25,26,27,28) |
| InChIKey | ALKJNCZNEOTEMP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xl-228 (CHEBI:755454) has role antineoplastic agent (CHEBI:35610) |
| xl-228 (CHEBI:755454) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| Exel-2280 | ChEMBL |
| Xl-228 | ChEMBL |
| XL228 | ChEMBL |
| Citations |
|---|