EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35N7O4 |
| Net Charge | 0 |
| Average Mass | 545.644 |
| Monoisotopic Mass | 545.27505 |
| SMILES | COCCN1CCN(Cc2ccc(-c3nnc4c3C(=O)c3c(NC(=O)NN5CCOCC5)cccc3-4)cc2)CC1 |
| InChI | InChI=1S/C29H35N7O4/c1-39-16-13-34-9-11-35(12-10-34)19-20-5-7-21(8-6-20)26-25-27(32-31-26)22-3-2-4-23(24(22)28(25)37)30-29(38)33-36-14-17-40-18-15-36/h2-8H,9-19H2,1H3,(H,31,32)(H2,30,33,38) |
| InChIKey | XLSYZSRXVVCHLS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rgb-286638 (CHEBI:755453) has role antineoplastic agent (CHEBI:35610) |
| rgb-286638 (CHEBI:755453) is a pyrazoles (CHEBI:26410) |
| rgb-286638 (CHEBI:755453) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| Rgb-286638 | ChEMBL |
| RGB 286638 | ChEMBL |
| Citations |
|---|