EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C49H66N10O10S2.HCl |
| Net Charge | 0 |
| Average Mass | 1092.183 |
| Monoisotopic Mass | 1090.39384 |
| SMILES | Cl.Cl.[H][C@]1(Cc2cnc3ccccc23)NC(=O)[C@]([H])(Cc2ccccc2)NC(=O)[C@@H](NC(=O)[C@H](N)Cc2ccccc2)CSSC[C@@]([H])(C(=O)N[C@H](CO)[C@@H](C)O)NC(=O)[C@]([H])([C@@H](C)O)NC(=O)[C@]([H])(CCCCN)NC1=O |
| InChI | InChI=1S/C49H66N10O10S2.2ClH/c1-28(61)39(25-60)56-48(68)41-27-71-70-26-40(57-43(63)34(51)21-30-13-5-3-6-14-30)47(67)54-37(22-31-15-7-4-8-16-31)45(65)55-38(23-32-24-52-35-18-10-9-17-33(32)35)46(66)53-36(19-11-12-20-50)44(64)59-42(29(2)62)49(69)58-41;;/h3-10,13-18,24,28-29,34,36-42,52,60-62H,11-12,19-23,25-27,50-51H2,1-2H3,(H,53,66)(H,54,67)(H,55,65)(H,56,68)(H,57,63)(H,58,69)(H,59,64);2*1H/t28-,29-,34-,36+,37+,38-,39-,40+,41+,42+;;/m1../s1 |
| InChIKey | PPJMKGDKFBCNIY-LODIGNQBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octreotide hydrochloride (CHEBI:755442) has role antineoplastic agent (CHEBI:35610) |
| octreotide hydrochloride (CHEBI:755442) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| CAM-2029 | ChEMBL |
| CAM2029 | ChEMBL |
| Octreotide dihydrochloride | ChEMBL |
| Octreotide hydrochloride | ChEMBL |
| Octreotide hydrochloride, (-)- | ChEMBL |
| SMS-995-AAA | ChEMBL |