EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C9H19BN2O3 |
| Net Charge | 0 |
| Average Mass | 310.181 |
| Monoisotopic Mass | 310.13699 |
| SMILES | CC(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C9H19BN2O3.CH4O3S/c1-6(2)8(11)9(13)12-5-3-4-7(12)10(14)15;1-5(2,3)4/h6-8,14-15H,3-5,11H2,1-2H3;1H3,(H,2,3,4)/t7-,8-;/m0./s1 |
| InChIKey | OXYYOEIGQRXGPI-WSZWBAFRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talabostat mesylate (CHEBI:755440) has role antineoplastic agent (CHEBI:35610) |
| talabostat mesylate (CHEBI:755440) is a valine derivative (CHEBI:27267) |
| Synonyms | Source |
|---|---|
| Talabostat mesilate | ChEMBL |
| Talabostat mesylate | ChEMBL |