EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C15H10I4NO4.Na |
| Net Charge | 0 |
| Average Mass | 816.869 |
| Monoisotopic Mass | 816.67921 |
| SMILES | N[C@H](Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)[O-].O.[Na+] |
| InChI | InChI=1S/C15H11I4NO4.Na.H2O/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23;;/h1-2,4-5,12,21H,3,20H2,(H,22,23);;1H2/q;+1;/p-1/t12-;;/m1../s1 |
| InChIKey | ANMYAHDLKVNJJO-CURYUGHLSA-M |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextrothyroxine sodium (CHEBI:755437) has role cardiovascular drug (CHEBI:35554) |
| dextrothyroxine sodium (CHEBI:755437) is a phenylalanine derivative (CHEBI:25985) |
| INNs | Source |
|---|---|
| dextrothyroxine sodique | WHO MedNet |
| dextrotiroxina de sodio | WHO MedNet |
| Synonyms | Source |
|---|---|
| Anhydrous dextrothyroxine sodium | ChEMBL |
| Dextrothyroxine sodium anhydrous | ChEMBL |
| Dextrothyroxine sodium hydrate | ChEMBL |
| D-thyroxine sodium salt | ChEMBL |
| Monosodium d-thyroxine hydrate | ChEMBL |
| Citations |
|---|