EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H66O14 |
| Net Charge | 0 |
| Average Mass | 806.987 |
| Monoisotopic Mass | 806.44526 |
| SMILES | [H][C@]1(O[C@@]2([H])C[C@H](O)[C@H](O[C@@]3([H])C[C@H](O)[C@H](O[C@@]4([H])C[C@H](OC(C)=O)[C@H](O)[C@@H](C)O4)[C@@H](C)O3)[C@@H](C)O2)CC[C@@]2(C)[C@]([H])(CC[C@]3([H])[C@]2([H])CC[C@]2(C)[C@@H](C4=CC(=O)OC4)CC[C@]32O)C1 |
| InChI | InChI=1S/C43H66O14/c1-21-38(48)33(54-24(4)44)19-37(51-21)57-40-23(3)53-36(18-32(40)46)56-39-22(2)52-35(17-31(39)45)55-27-9-12-41(5)26(16-27)7-8-30-29(41)10-13-42(6)28(11-14-43(30,42)49)25-15-34(47)50-20-25/h15,21-23,26-33,35-40,45-46,48-49H,7-14,16-20H2,1-6H3/t21-,22-,23-,26-,27+,28-,29+,30-,31+,32+,33+,35+,36+,37+,38-,39-,40-,41+,42-,43+/m1/s1 |
| InChIKey | HPMZBILYSWLILX-UMDUKNJSSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetyldigitoxin (CHEBI:755436) has role cardiovascular drug (CHEBI:35554) |
| acetyldigitoxin (CHEBI:755436) is a cardenolide glycoside (CHEBI:38092) |
| INN | Source |
|---|---|
| acetyldigitoxine | WHO MedNet |
| Synonym | Source |
|---|---|
| Acetyldigitoxins .alpha.-form | ChEMBL |
| Citations |
|---|