EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27N3O7S |
| Net Charge | 0 |
| Average Mass | 501.561 |
| Monoisotopic Mass | 501.15697 |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCN(c3ccc(-c4ncco4)c(OCC(=O)O)c3)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O7S/c1-17(2)34-19-4-6-20(7-5-19)35(30,31)27-12-10-26(11-13-27)18-3-8-21(24-25-9-14-32-24)22(15-18)33-16-23(28)29/h3-9,14-15,17H,10-13,16H2,1-2H3,(H,28,29) |
| InChIKey | ZMZNWNTZRWXTJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asapiprant (CHEBI:755432) has role antiviral agent (CHEBI:22587) |
| asapiprant (CHEBI:755432) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| asapiprant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bge 175 | ChEMBL |
| Bge-175 | ChEMBL |
| BGE175 | ChEMBL |
| S-555739 | ChEMBL |