EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H13F2NO3 |
| Net Charge | 0 |
| Average Mass | 341.313 |
| Monoisotopic Mass | 341.08635 |
| SMILES | O=C(c1ccc(O)c(F)c1)N(c1ccc(O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13F2NO3/c20-13-2-4-14(5-3-13)22(15-6-8-16(23)9-7-15)19(25)12-1-10-18(24)17(21)11-12/h1-11,23-24H |
| InChIKey | FBCQEUMZZNVQKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gtx-758 (CHEBI:755420) has role antineoplastic agent (CHEBI:35610) |
| gtx-758 (CHEBI:755420) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Gtx 758 | ChEMBL |
| Gtx-758 | ChEMBL |
| Brand Name | Source |
|---|---|
| Capesaris | ChEMBL |