EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20FNO2S |
| Net Charge | 0 |
| Average Mass | 285.384 |
| Monoisotopic Mass | 285.11988 |
| SMILES | CCN1CCC(c2cccc(S(C)(=O)=O)c2F)CC1 |
| InChI | InChI=1S/C14H20FNO2S/c1-3-16-9-7-11(8-10-16)12-5-4-6-13(14(12)15)19(2,17)18/h4-6,11H,3,7-10H2,1-2H3 |
| InChIKey | UKUPJASJNQDHPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ordopidine (CHEBI:755417) has role antiparkinson drug (CHEBI:48407) |
| ordopidine (CHEBI:755417) is a piperidines (CHEBI:26151) |
| INNs | Source |
|---|---|
| ordopidina | WHO MedNet |
| ordopidine | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACR-325 | ChEMBL |
| ACR325 | ChEMBL |