EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C26H26N3O5S.Na |
| Net Charge | 0 |
| Average Mass | 533.582 |
| Monoisotopic Mass | 533.15965 |
| SMILES | COc1c(-c2ccc3cc(NS(C)(=O)=O)ccc3c2)cc(-n2ccc(=O)[n-]c2=O)cc1C(C)(C)C.O.[Na+] |
| InChI | InChI=1S/C26H27N3O5S.Na.H2O/c1-26(2,3)22-15-20(29-11-10-23(30)27-25(29)31)14-21(24(22)34-4)18-7-6-17-13-19(28-35(5,32)33)9-8-16(17)12-18;;/h6-15,28H,1-5H3,(H,27,30,31);;1H2/q;+1;/p-1 |
| InChIKey | SJHKKWUESHNTBB-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dasabuvir sodium monohydrate (CHEBI:755404) has role antiviral agent (CHEBI:22587) |
| dasabuvir sodium monohydrate (CHEBI:755404) is a benzenes (CHEBI:22712) |
| dasabuvir sodium monohydrate (CHEBI:755404) is a naphthalenes (CHEBI:25477) |
| dasabuvir sodium monohydrate (CHEBI:755404) is a ring assembly (CHEBI:36820) |