EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H72N8O6 |
| Net Charge | 0 |
| Average Mass | 1001.286 |
| Monoisotopic Mass | 1000.55748 |
| SMILES | [H][C@@]12CCCC[C@]1([H])N(C(=O)[C@@]([H])(NC(=O)OC)C(C)C)[C@]([H])(c1nc3ccc(-c4cc5ccc4CCc4ccc(c(-c6ccc7nc([C@]8([H])C[C@]9([H])CCCC[C@]9([H])N8C(=O)[C@@]([H])(NC(=O)OC)C(C)C)nc7c6)c4)CC5)cc3n1)C2 |
| InChI | InChI=1S/C60H72N8O6/c1-33(2)53(65-59(71)73-5)57(69)67-49-13-9-7-11-41(49)31-51(67)55-61-45-25-23-39(29-47(45)63-55)43-27-35-15-19-37(43)21-17-36-16-20-38(22-18-35)44(28-36)40-24-26-46-48(30-40)64-56(62-46)52-32-42-12-8-10-14-50(42)68(52)58(70)54(34(3)4)66-60(72)74-6/h15-16,19-20,23-30,33-34,41-42,49-54H,7-14,17-18,21-22,31-32H2,1-6H3,(H,61,63)(H,62,64)(H,65,71)(H,66,72)/t41-,42-,49-,50-,51-,52-,53-,54-/m0/s1 |
| InChIKey | LSYBRGMTRKJATA-IVEWBXRVSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| odalasvir (CHEBI:755400) has role antiviral agent (CHEBI:22587) |
| odalasvir (CHEBI:755400) is a valine derivative (CHEBI:27267) |
| INN | Source |
|---|---|
| odalasvir | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACH-0143102 | ChEMBL |
| ACH-3102 | ChEMBL |