EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N6O6S |
| Net Charge | 0 |
| Average Mass | 410.412 |
| Monoisotopic Mass | 410.10085 |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2ncccc2C(=O)N(C)C)n1 |
| InChI | InChI=1S/C15H18N6O6S/c1-21(2)13(22)9-6-5-7-16-12(9)28(24,25)20-15(23)19-14-17-10(26-3)8-11(18-14)27-4/h5-8H,1-4H3,(H2,17,18,19,20,23) |
| InChIKey | RTCOGUMHFFWOJV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicosulfuron (CHEBI:7554) has role environmental contaminant (CHEBI:78298) |
| nicosulfuron (CHEBI:7554) has role herbicide (CHEBI:24527) |
| nicosulfuron (CHEBI:7554) has role xenobiotic (CHEBI:35703) |
| nicosulfuron (CHEBI:7554) is a N-sulfonylurea (CHEBI:76983) |
| nicosulfuron (CHEBI:7554) is a pyridines (CHEBI:26421) |
| nicosulfuron (CHEBI:7554) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-N,N-dimethylpyridine-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| C10949 | KEGG COMPOUND |
| nicosulfuron | Alan Wood's Pesticides |
| 484 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7233432 | Reaxys |
| CAS:111991-09-4 | KEGG COMPOUND |
| CAS:111991-09-4 | ChemIDplus |
| Citations |
|---|