EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30ClFN4O4 |
| Net Charge | 0 |
| Average Mass | 492.979 |
| Monoisotopic Mass | 492.19396 |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN(CC[C@H](OC(N)=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H30ClFN4O4/c1-33-22-13-20(27)19(25)12-18(22)23(31)29-14-15-6-9-30(10-7-15)11-8-21(34-24(28)32)16-2-4-17(26)5-3-16/h2-5,12-13,15,21H,6-11,14,27H2,1H3,(H2,28,32)(H,29,31)/t21-/m0/s1 |
| InChIKey | KGMMSPVVHZGPHL-NRFANRHFSA-N |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| relenopride (CHEBI:755398) has functional parent benzyl alcohol (CHEBI:17987) |
| relenopride (CHEBI:755398) has role laxative (CHEBI:50503) |
| relenopride (CHEBI:755398) is a carboxylic ester (CHEBI:33308) |
| INNs | Source |
|---|---|
| relenoprida | WHO MedNet |
| relenopride | WHO MedNet |
| Synonyms | Source |
|---|---|
| YKP-10811 | ChEMBL |
| YKP10811 | ChEMBL |