EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755396 - dextroamphetamine sulfate
| Formula | C9H13N.H2O4S.C9H13N |
| Net Charge | 0 |
| Average Mass | 368.499 |
| Monoisotopic Mass | 368.17698 |
| SMILES | C[C@H](N)Cc1ccccc1.C[C@H](N)Cc1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H13N.H2O4S/c2*1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2*2-6,8H,7,10H2,1H3;(H2,1,2,3,4)/t2*8-;/m00./s1 |
| InChIKey | PYHRZPFZZDCOPH-QXGOIDDHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextroamphetamine sulfate (CHEBI:755396) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| D-amphetamine hemisulfate salt | ChEMBL |
| Dexamfetamine sulfate | ChEMBL |
| Dexamphetamine sulphate | ChEMBL |
| Dextroamphetamine sulfate cii | ChEMBL |
| NSC-27104 | ChEMBL |
| Brand Names | Source |
|---|---|
| Dexampex | ChEMBL |
| Dexedrine | ChEMBL |
| Dexedrine spansule | ChEMBL |
| Dextroamphetamine sulfate component of delcobese | ChEMBL |
| Dextroamphetamine sulfate component of mydayis | ChEMBL |
| Dextrostat | ChEMBL |
| Citations |
|---|