EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H11N3O2S |
| Net Charge | 0 |
| Average Mass | 333.372 |
| Monoisotopic Mass | 333.05720 |
| SMILES | O=C1NC(=O)/C(=C/c2ccc3nccc(-c4ccncc4)c3c2)S1 |
| InChI | InChI=1S/C18H11N3O2S/c22-17-16(24-18(23)21-17)10-11-1-2-15-14(9-11)13(5-8-20-15)12-3-6-19-7-4-12/h1-10H,(H,21,22,23)/b16-10- |
| InChIKey | QDITZBLZQQZVEE-YBEGLDIGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-1059615 (CHEBI:755394) has role antineoplastic agent (CHEBI:35610) |
| gsk-1059615 (CHEBI:755394) is a bipyridines (CHEBI:50511) |
| Synonyms | Source |
|---|---|
| Gsk-1059615 | ChEMBL |
| GSK1059615 | ChEMBL |
| GSK-615 | ChEMBL |
| GSK615 | ChEMBL |
| Citations |
|---|