EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16ClN3O |
| Net Charge | 0 |
| Average Mass | 313.788 |
| Monoisotopic Mass | 313.09819 |
| SMILES | NC[C@@](O)(c1ccc(Cl)cc1)c1ccc(-c2cnnc2)cc1 |
| InChI | InChI=1S/C17H16ClN3O/c18-16-7-5-15(6-8-16)17(22,11-19)14-3-1-12(2-4-14)13-9-20-21-10-13/h1-10,22H,11,19H2,(H,20,21)/t17-/m0/s1 |
| InChIKey | IIRWNGPLJQXWFJ-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| at-13148 (CHEBI:755391) has role antineoplastic agent (CHEBI:35610) |
| at-13148 (CHEBI:755391) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| At-13148 | ChEMBL |
| AT13148 | ChEMBL |
| Citations |
|---|