EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755371 - rapastinel
| Formula | C18H31N5O6 |
| Net Charge | 0 |
| Average Mass | 413.475 |
| Monoisotopic Mass | 413.22743 |
| SMILES | [H][C@@]1(C(=O)N[C@]([H])(C(N)=O)[C@@H](C)O)CCCN1C(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(N)[C@@H](C)O |
| InChI | InChI=1S/C18H31N5O6/c1-9(24)13(19)18(29)23-8-4-6-12(23)17(28)22-7-3-5-11(22)16(27)21-14(10(2)25)15(20)26/h9-14,24-25H,3-8,19H2,1-2H3,(H2,20,26)(H,21,27)/t9-,10-,11+,12+,13+,14+/m1/s1 |
| InChIKey | GIBQQARAXHVEGD-BSOLPCOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rapastinel (CHEBI:755371) has role antidepressant (CHEBI:35469) |
| rapastinel (CHEBI:755371) is a polypeptide (CHEBI:15841) |
| INN | Source |
|---|---|
| rapastinel | WHO MedNet |
| Synonyms | Source |
|---|---|
| GLYX-13 | ChEMBL |
| Rapastinelum | ChEMBL |
| Tppt-amide | ChEMBL |